C19H23INO3- — CID 155620126
benzyl 2-(aminoiodanuidylmethyl)-3-(4-hydroxy-2,6-dimethylphenyl)propanoate (PubChem CID 155620126) has the molecular formula C19H23INO3- and a molecular weight of 440.30 g/mol. Its IUPAC name is benzyl 2-(aminoiodanuidylmethyl)-3-(4-hydroxy-2,6-dimethylphenyl)propanoate.
| Compound Name | benzyl 2-(aminoiodanuidylmethyl)-3-(4-hydroxy-2,6-dimethylphenyl)propanoate |
|---|---|
| PubChem CID | 155620126 |
| Molecular Formula | C19H23INO3- |
| Molecular Weight | 440.30 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | benzyl 2-(aminoiodanuidylmethyl)-3-(4-hydroxy-2,6-dimethylphenyl)propanoate |
| SMILES | Cc1cc(O)cc(C)c1CC(C[I-]N)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H23INO3/c1-13-8-17(22)9-14(2)18(13)10-16(11-20-21)19(23)24-12-15-6-4-3-5-7-15/h3-9,16,22H,10-12,21H2,1-2H3/q-1 |
| InChIKey | GIQVBYAOMMVWJB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|