C19H21NO3 — CID 155620147
2-[(4-butan-2-ylphenyl)methyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 155620147) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-[(4-butan-2-ylphenyl)methyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 2-[(4-butan-2-ylphenyl)methyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 155620147 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-[(4-butan-2-ylphenyl)methyl]-3a,4,7,7a-tetrahydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | CCC(C)c1ccc(CN2C(=O)C3C4C=CC(O4)C3C2=O)cc1 |
| InChI | InChI=1S/C19H21NO3/c1-3-11(2)13-6-4-12(5-7-13)10-20-18(21)16-14-8-9-15(23-14)17(16)19(20)22/h4-9,11,14-17H,3,10H2,1-2H3 |
| InChIKey | CLZKQJXGFOCUFH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|