C37H46F2IrNO2Si- — CID 155620493
(E)-3,7-diethyl-5-fluoro-6-hydroxynon-5-en-4-one;[4-(3,5-dimethylbenzene-6-id-1-yl)-7-fluorobenzo[f]isoquinolin-8-yl]-trimethylsilane;iridium (PubChem CID 155620493) has the molecular formula C37H46F2IrNO2Si- and a molecular weight of 795.08 g/mol. Its IUPAC name is (E)-3,7-diethyl-5-fluoro-6-hydroxynon-5-en-4-one;[4-(3,5-dimethylbenzene-6-id-1-yl)-7-fluorobenzo[f]isoquinolin-8-yl]-trimethylsilane;iridium.
| Compound Name | (E)-3,7-diethyl-5-fluoro-6-hydroxynon-5-en-4-one;[4-(3,5-dimethylbenzene-6-id-1-yl)-7-fluorobenzo[f]isoquinolin-8-yl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 155620493 |
| Molecular Formula | C37H46F2IrNO2Si- |
| Molecular Weight | 795.08 g/mol |
| Exact Mass | 795.29 |
| IUPAC Name | (E)-3,7-diethyl-5-fluoro-6-hydroxynon-5-en-4-one;[4-(3,5-dimethylbenzene-6-id-1-yl)-7-fluorobenzo[f]isoquinolin-8-yl]-trimethylsilane;iridium |
| SMILES | CCC(CC)C(=O)/C(F)=C(\O)C(CC)CC.Cc1[c-]c(-c2nccc3c2ccc2c(F)c([Si](C)(C)C)ccc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C24H23FNSi.C13H23FO2.Ir/c1-15-12-16(2)14-17(13-15)24-21-7-6-20-18(19(21)10-11-26-24)8-9-22(23(20)25)27(3,4)5;1-5-9(6-2)12(15)11(14)13(16)10(7-3)8-4;/h6-13H,1-5H3;9-10,15H,5-8H2,1-4H3;/q-1;;/b;12-11+; |
| InChIKey | MWAKPRHWQYTFGC-ITTKMUPFSA-N |
| XLogP | 10.32 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 795.08 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|