C8H3BrF5NO3S — CID 155621555
4-bromo-2,6-difluoro-N-(trifluoromethylsulfonyl)benzamide (PubChem CID 155621555) has the molecular formula C8H3BrF5NO3S and a molecular weight of 368.08 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-(trifluoromethylsulfonyl)benzamide.
| Compound Name | 4-bromo-2,6-difluoro-N-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 155621555 |
| Molecular Formula | C8H3BrF5NO3S |
| Molecular Weight | 368.08 g/mol |
| Exact Mass | 366.89 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-(trifluoromethylsulfonyl)benzamide |
| SMILES | O=C(NS(=O)(=O)C(F)(F)F)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C8H3BrF5NO3S/c9-3-1-4(10)6(5(11)2-3)7(16)15-19(17,18)8(12,13)14/h1-2H,(H,15,16) |
| InChIKey | JBIHWENRBVFDLT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.08 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |