C20H25ClN6O3S2 — CID 155621967
2-[[[4-(4-amino-2-methoxyanilino)-5-chloropyrimidin-2-yl]amino]methyl]-N,N-diethylthiophene-3-sulfonamide (PubChem CID 155621967) has the molecular formula C20H25ClN6O3S2 and a molecular weight of 497.05 g/mol. Its IUPAC name is 2-[[[4-(4-amino-2-methoxyanilino)-5-chloropyrimidin-2-yl]amino]methyl]-N,N-diethylthiophene-3-sulfonamide.
| Compound Name | 2-[[[4-(4-amino-2-methoxyanilino)-5-chloropyrimidin-2-yl]amino]methyl]-N,N-diethylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 155621967 |
| Molecular Formula | C20H25ClN6O3S2 |
| Molecular Weight | 497.05 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 2-[[[4-(4-amino-2-methoxyanilino)-5-chloropyrimidin-2-yl]amino]methyl]-N,N-diethylthiophene-3-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccsc1CNc1ncc(Cl)c(Nc2ccc(N)cc2OC)n1 |
| InChI | InChI=1S/C20H25ClN6O3S2/c1-4-27(5-2)32(28,29)18-8-9-31-17(18)12-24-20-23-11-14(21)19(26-20)25-15-7-6-13(22)10-16(15)30-3/h6-11H,4-5,12,22H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | KQBVZXHHYQSWJV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 122.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.05 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|