C17H18ClN5O2S2 — CID 145195348
2-N-(3-aminophenyl)-5-chloro-4-N-(2-propan-2-ylsulfonylthiophen-3-yl)pyrimidine-2,4-diamine (PubChem CID 145195348) has the molecular formula C17H18ClN5O2S2 and a molecular weight of 423.95 g/mol. Its IUPAC name is 2-N-(3-aminophenyl)-5-chloro-4-N-(2-propan-2-ylsulfonylthiophen-3-yl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-aminophenyl)-5-chloro-4-N-(2-propan-2-ylsulfonylthiophen-3-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 145195348 |
| Molecular Formula | C17H18ClN5O2S2 |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 2-N-(3-aminophenyl)-5-chloro-4-N-(2-propan-2-ylsulfonylthiophen-3-yl)pyrimidine-2,4-diamine |
| SMILES | CC(C)S(=O)(=O)c1sccc1Nc1nc(Nc2cccc(N)c2)ncc1Cl |
| InChI | InChI=1S/C17H18ClN5O2S2/c1-10(2)27(24,25)16-14(6-7-26-16)22-15-13(18)9-20-17(23-15)21-12-5-3-4-11(19)8-12/h3-10H,19H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | FMERLHOQQLHSDY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|