C22H30N2O4 — CID 155622729
1-[2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]but-3-enyl N-benzylcarbamate (PubChem CID 155622729) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 1-[2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]but-3-enyl N-benzylcarbamate.
| Compound Name | 1-[2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]but-3-enyl N-benzylcarbamate |
|---|---|
| PubChem CID | 155622729 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 1-[2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]but-3-enyl N-benzylcarbamate |
| SMILES | C=CCC(OC(=O)NCc1ccccc1)C1(NC(=O)OC(C)(C)C)CC1C=C |
| InChI | InChI=1S/C22H30N2O4/c1-6-11-18(27-19(25)23-15-16-12-9-8-10-13-16)22(14-17(22)7-2)24-20(26)28-21(3,4)5/h6-10,12-13,17-18H,1-2,11,14-15H2,3-5H3,(H,23,25)(H,24,26) |
| InChIKey | QRDFOJHXWVWYON-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|