C34H41F2O8S2+ — CID 155623550
[4-(2,2-difluoro-2-sulfoethoxy)phenyl]-bis[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium (PubChem CID 155623550) has the molecular formula C34H41F2O8S2+ and a molecular weight of 679.82 g/mol. Its IUPAC name is [4-(2,2-difluoro-2-sulfoethoxy)phenyl]-bis[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium.
| Compound Name | [4-(2,2-difluoro-2-sulfoethoxy)phenyl]-bis[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 155623550 |
| Molecular Formula | C34H41F2O8S2+ |
| Molecular Weight | 679.82 g/mol |
| Exact Mass | 679.22 |
| IUPAC Name | [4-(2,2-difluoro-2-sulfoethoxy)phenyl]-bis[4-(2,5,5-trimethyl-1,3-dioxan-2-yl)phenyl]sulfanium |
| SMILES | CC1(C)COC(C)(c2ccc([S+](c3ccc(OCC(F)(F)S(=O)(=O)O)cc3)c3ccc(C4(C)OCC(C)(C)CO4)cc3)cc2)OC1 |
| InChI | InChI=1S/C34H40F2O8S2/c1-30(2)19-41-32(5,42-20-30)24-7-13-27(14-8-24)45(29-17-11-26(12-18-29)40-23-34(35,36)46(37,38)39)28-15-9-25(10-16-28)33(6)43-21-31(3,4)22-44-33/h7-18H,19-23H2,1-6H3/p+1 |
| InChIKey | YUZZXEUMJVFEHP-UHFFFAOYSA-O |
| XLogP | 7.13 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.82 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|