C32H40FO2S+ — CID 155623560
(4-tert-butylphenyl)-(4-fluorophenyl)-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium (PubChem CID 155623560) has the molecular formula C32H40FO2S+ and a molecular weight of 507.74 g/mol. Its IUPAC name is (4-tert-butylphenyl)-(4-fluorophenyl)-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium.
| Compound Name | (4-tert-butylphenyl)-(4-fluorophenyl)-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium |
|---|---|
| PubChem CID | 155623560 |
| Molecular Formula | C32H40FO2S+ |
| Molecular Weight | 507.74 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | (4-tert-butylphenyl)-(4-fluorophenyl)-[4-(2,5,5-trimethyl-4-propan-2-yl-1,3-dioxan-2-yl)phenyl]sulfanium |
| SMILES | CC(C)C1OC(C)(c2ccc([S+](c3ccc(F)cc3)c3ccc(C(C)(C)C)cc3)cc2)OCC1(C)C |
| InChI | InChI=1S/C32H40FO2S/c1-22(2)29-31(6,7)21-34-32(8,35-29)24-11-17-27(18-12-24)36(28-19-13-25(33)14-20-28)26-15-9-23(10-16-26)30(3,4)5/h9-20,22,29H,21H2,1-8H3/q+1 |
| InChIKey | POJXQRDZWKDNLC-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.74 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|