C20H21FO3S2 — CID 54264278
O-methyl 4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylbenzenecarbothioate (PubChem CID 54264278) has the molecular formula C20H21FO3S2 and a molecular weight of 392.52 g/mol. Its IUPAC name is O-methyl 4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylbenzenecarbothioate.
| Compound Name | O-methyl 4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylbenzenecarbothioate |
|---|---|
| PubChem CID | 54264278 |
| Molecular Formula | C20H21FO3S2 |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | O-methyl 4-[3-fluoro-5-(4-methoxyoxan-4-yl)phenyl]sulfanylbenzenecarbothioate |
| SMILES | COC(=S)c1ccc(Sc2cc(F)cc(C3(OC)CCOCC3)c2)cc1 |
| InChI | InChI=1S/C20H21FO3S2/c1-22-19(25)14-3-5-17(6-4-14)26-18-12-15(11-16(21)13-18)20(23-2)7-9-24-10-8-20/h3-6,11-13H,7-10H2,1-2H3 |
| InChIKey | RFQWNHWHRMTGKO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|