C26H30ClF2N7O4 — CID 155624406
2-[4-chloro-2-[[2-[4-[(3S,4R)-3-(dimethylamino)-4-fluoropyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol (PubChem CID 155624406) has the molecular formula C26H30ClF2N7O4 and a molecular weight of 578.02 g/mol. Its IUPAC name is 2-[4-chloro-2-[[2-[4-[(3S,4R)-3-(dimethylamino)-4-fluoropyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol.
| Compound Name | 2-[4-chloro-2-[[2-[4-[(3S,4R)-3-(dimethylamino)-4-fluoropyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 155624406 |
| Molecular Formula | C26H30ClF2N7O4 |
| Molecular Weight | 578.02 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | 2-[4-chloro-2-[[2-[4-[(3S,4R)-3-(dimethylamino)-4-fluoropyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol |
| SMILES | COc1cc(N2C[C@@H](F)[C@@H](N(C)C)C2)c([N+](=O)[O-])cc1Nc1nccc(Nc2cc(Cl)c(F)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C26H30ClF2N7O4/c1-26(2,37)14-8-16(28)15(27)9-18(14)31-24-6-7-30-25(33-24)32-19-10-21(36(38)39)20(11-23(19)40-5)35-12-17(29)22(13-35)34(3)4/h6-11,17,22,37H,12-13H2,1-5H3,(H2,30,31,32,33)/t17-,22+/m1/s1 |
| InChIKey | GHCHSSOGMAUICW-VGSWGCGISA-N |
| XLogP | 4.99 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.02 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|