C27H33ClFN7O4 — CID 155624433
2-[4-chloro-5-fluoro-2-[[2-[2-methoxy-4-[methyl-[[(2R,4S)-4-methylpyrrolidin-2-yl]methyl]amino]-5-nitroanilino]pyrimidin-4-yl]amino]phenyl]propan-2-ol (PubChem CID 155624433) has the molecular formula C27H33ClFN7O4 and a molecular weight of 574.06 g/mol. Its IUPAC name is 2-[4-chloro-5-fluoro-2-[[2-[2-methoxy-4-[methyl-[[(2R,4S)-4-methylpyrrolidin-2-yl]methyl]amino]-5-nitroanilino]pyrimidin-4-yl]amino]phenyl]propan-2-ol.
| Compound Name | 2-[4-chloro-5-fluoro-2-[[2-[2-methoxy-4-[methyl-[[(2R,4S)-4-methylpyrrolidin-2-yl]methyl]amino]-5-nitroanilino]pyrimidin-4-yl]amino]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 155624433 |
| Molecular Formula | C27H33ClFN7O4 |
| Molecular Weight | 574.06 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 2-[4-chloro-5-fluoro-2-[[2-[2-methoxy-4-[methyl-[[(2R,4S)-4-methylpyrrolidin-2-yl]methyl]amino]-5-nitroanilino]pyrimidin-4-yl]amino]phenyl]propan-2-ol |
| SMILES | COc1cc(N(C)C[C@H]2C[C@H](C)CN2)c([N+](=O)[O-])cc1Nc1nccc(Nc2cc(Cl)c(F)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C27H33ClFN7O4/c1-15-8-16(31-13-15)14-35(4)22-12-24(40-5)21(11-23(22)36(38)39)33-26-30-7-6-25(34-26)32-20-10-18(28)19(29)9-17(20)27(2,3)37/h6-7,9-12,15-16,31,37H,8,13-14H2,1-5H3,(H2,30,32,33,34)/t15-,16+/m0/s1 |
| InChIKey | MQFQAEWAULDZEM-JKSUJKDBSA-N |
| XLogP | 5.33 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.06 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|