C27H33ClFN7O4 — CID 155624450
2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]butan-2-ol (PubChem CID 155624450) has the molecular formula C27H33ClFN7O4 and a molecular weight of 574.06 g/mol. Its IUPAC name is 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]butan-2-ol.
| Compound Name | 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]butan-2-ol |
|---|---|
| PubChem CID | 155624450 |
| Molecular Formula | C27H33ClFN7O4 |
| Molecular Weight | 574.06 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]butan-2-ol |
| SMILES | CCC(C)(O)c1cc(F)c(Cl)cc1Nc1ccnc(Nc2cc([N+](=O)[O-])c(N3CC[C@@H](N(C)C)C3)cc2OC)n1 |
| InChI | InChI=1S/C27H33ClFN7O4/c1-6-27(2,37)17-11-19(29)18(28)12-20(17)31-25-7-9-30-26(33-25)32-21-13-23(36(38)39)22(14-24(21)40-5)35-10-8-16(15-35)34(3)4/h7,9,11-14,16,37H,6,8,10,15H2,1-5H3,(H2,30,31,32,33)/t16-,27?/m1/s1 |
| InChIKey | JJHGLQDURVHIGV-DKEDTHNGSA-N |
| XLogP | 5.43 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.06 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|