C27H30ClF4N7O4 — CID 155624454
2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol (PubChem CID 155624454) has the molecular formula C27H30ClF4N7O4 and a molecular weight of 628.03 g/mol. Its IUPAC name is 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol.
| Compound Name | 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol |
|---|---|
| PubChem CID | 155624454 |
| Molecular Formula | C27H30ClF4N7O4 |
| Molecular Weight | 628.03 g/mol |
| Exact Mass | 627.20 |
| IUPAC Name | 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-fluorophenyl]propan-2-ol |
| SMILES | COc1cc(N2CC[C@@H](N(C)C)C2)c([N+](=O)[O-])cc1Nc1ncc(C(F)(F)F)c(Nc2cc(Cl)c(F)cc2C(C)(C)O)n1 |
| InChI | InChI=1S/C27H30ClF4N7O4/c1-26(2,40)15-8-18(29)17(28)9-19(15)34-24-16(27(30,31)32)12-33-25(36-24)35-20-10-22(39(41)42)21(11-23(20)43-5)38-7-6-14(13-38)37(3)4/h8-12,14,40H,6-7,13H2,1-5H3,(H2,33,34,35,36)/t14-/m1/s1 |
| InChIKey | NWBSLPIAYHJCCM-CQSZACIVSA-N |
| XLogP | 6.06 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.03 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|