C26H28ClF4N7O4 — CID 155624483
2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]-1,1,1-trifluoropropan-2-ol (PubChem CID 155624483) has the molecular formula C26H28ClF4N7O4 and a molecular weight of 614.00 g/mol. Its IUPAC name is 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 155624483 |
| Molecular Formula | C26H28ClF4N7O4 |
| Molecular Weight | 614.00 g/mol |
| Exact Mass | 613.18 |
| IUPAC Name | 2-[4-chloro-2-[[2-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-2-methoxy-5-nitroanilino]pyrimidin-4-yl]amino]-5-fluorophenyl]-1,1,1-trifluoropropan-2-ol |
| SMILES | COc1cc(N2CC[C@@H](N(C)C)C2)c([N+](=O)[O-])cc1Nc1nccc(Nc2cc(Cl)c(F)cc2C(C)(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C26H28ClF4N7O4/c1-25(39,26(29,30)31)15-9-17(28)16(27)10-18(15)33-23-5-7-32-24(35-23)34-19-11-21(38(40)41)20(12-22(19)42-4)37-8-6-14(13-37)36(2)3/h5,7,9-12,14,39H,6,8,13H2,1-4H3,(H2,32,33,34,35)/t14-,25?/m1/s1 |
| InChIKey | ZPZOGWGGJWPQKG-SUUGVPPDSA-N |
| XLogP | 5.58 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.00 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|