C6H12F2NO- — CID 155624983
3-(2,2-difluoroethoxy)propyl-methylazanide (PubChem CID 155624983) has the molecular formula C6H12F2NO- and a molecular weight of 152.16 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)propyl-methylazanide.
| Compound Name | 3-(2,2-difluoroethoxy)propyl-methylazanide |
|---|---|
| PubChem CID | 155624983 |
| Molecular Formula | C6H12F2NO- |
| Molecular Weight | 152.16 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | 3-(2,2-difluoroethoxy)propyl-methylazanide |
| SMILES | C[N-]CCCOCC(F)F |
| InChI | InChI=1S/C6H12F2NO/c1-9-3-2-4-10-5-6(7)8/h6H,2-5H2,1H3/q-1 |
| InChIKey | WVXNTEVLSURDCZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|