C7H14F3NO — CID 166445925
(1R)-N,N-dimethyl-1-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 166445925) has the molecular formula C7H14F3NO and a molecular weight of 185.19 g/mol. Its IUPAC name is (1R)-N,N-dimethyl-1-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | (1R)-N,N-dimethyl-1-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 166445925 |
| Molecular Formula | C7H14F3NO |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (1R)-N,N-dimethyl-1-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | CC[C@@H](OCC(F)(F)F)N(C)C |
| InChI | InChI=1S/C7H14F3NO/c1-4-6(11(2)3)12-5-7(8,9)10/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | QRUGQVPFECXMBG-ZCFIWIBFSA-N |
| XLogP | 1.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|