C5H11F2NO — CID 174823239
1-(difluoromethoxy)-N,N-dimethylethanamine (PubChem CID 174823239) has the molecular formula C5H11F2NO and a molecular weight of 139.15 g/mol. Its IUPAC name is 1-(difluoromethoxy)-N,N-dimethylethanamine.
| Compound Name | 1-(difluoromethoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 174823239 |
| Molecular Formula | C5H11F2NO |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | 1-(difluoromethoxy)-N,N-dimethylethanamine |
| SMILES | CC(OC(F)F)N(C)C |
| InChI | InChI=1S/C5H11F2NO/c1-4(8(2)3)9-5(6)7/h4-5H,1-3H3 |
| InChIKey | PDZNFTINQIIOQW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|