C13H23F3N3+ — CID 155627875
[1-(4-aminobutyl)pyrrol-3-yl]methyl-dimethyl-(2,2,2-trifluoroethyl)azanium (PubChem CID 155627875) has the molecular formula C13H23F3N3+ and a molecular weight of 278.34 g/mol. Its IUPAC name is [1-(4-aminobutyl)pyrrol-3-yl]methyl-dimethyl-(2,2,2-trifluoroethyl)azanium.
| Compound Name | [1-(4-aminobutyl)pyrrol-3-yl]methyl-dimethyl-(2,2,2-trifluoroethyl)azanium |
|---|---|
| PubChem CID | 155627875 |
| Molecular Formula | C13H23F3N3+ |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | [1-(4-aminobutyl)pyrrol-3-yl]methyl-dimethyl-(2,2,2-trifluoroethyl)azanium |
| SMILES | C[N+](C)(Cc1ccn(CCCCN)c1)CC(F)(F)F |
| InChI | InChI=1S/C13H23F3N3/c1-19(2,11-13(14,15)16)10-12-5-8-18(9-12)7-4-3-6-17/h5,8-9H,3-4,6-7,10-11,17H2,1-2H3/q+1 |
| InChIKey | DMFIVWDXRSQYFH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|