About N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine
N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine (PubChem CID 155627890) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine.
Analyze N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine?
The IUPAC name of N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine (CID 155627890) is N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine.
What is the SMILES notation for N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine?
The canonical SMILES for N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine is CNC1=CC(SC)CC=C1.
What is the InChIKey of N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine?
The InChIKey is OBBBVIWJEJRPFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-9-7-4-3-5-8(6-7)10-2/h3-4,6,8-9H,5H2,1-2H3.
What are the key properties of N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine?
N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine has a molecular weight of 155.27 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-methylsulfanylcyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 155627890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).