C22H31ClN2O3Si — CID 155629323
3-acetyl-1-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-7-chloro-4-methyl-1,6-naphthyridin-2-one (PubChem CID 155629323) has the molecular formula C22H31ClN2O3Si and a molecular weight of 435.04 g/mol. Its IUPAC name is 3-acetyl-1-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-7-chloro-4-methyl-1,6-naphthyridin-2-one.
| Compound Name | 3-acetyl-1-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-7-chloro-4-methyl-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 155629323 |
| Molecular Formula | C22H31ClN2O3Si |
| Molecular Weight | 435.04 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 3-acetyl-1-[(1R,3S)-3-[tert-butyl(dimethyl)silyl]oxycyclopentyl]-7-chloro-4-methyl-1,6-naphthyridin-2-one |
| SMILES | CC(=O)c1c(C)c2cnc(Cl)cc2n([C@@H]2CC[C@H](O[Si](C)(C)C(C)(C)C)C2)c1=O |
| InChI | InChI=1S/C22H31ClN2O3Si/c1-13-17-12-24-19(23)11-18(17)25(21(27)20(13)14(2)26)15-8-9-16(10-15)28-29(6,7)22(3,4)5/h11-12,15-16H,8-10H2,1-7H3/t15-,16+/m1/s1 |
| InChIKey | LTXRZJHAHPYINY-CVEARBPZSA-N |
| XLogP | 5.68 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.04 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|