C26H21BrN2O5 — CID 155631828
methyl (2R,3S,4R,5S,6R)-6-(4-bromophenyl)-3-cyano-2-hydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate (PubChem CID 155631828) has the molecular formula C26H21BrN2O5 and a molecular weight of 521.37 g/mol. Its IUPAC name is methyl (2R,3S,4R,5S,6R)-6-(4-bromophenyl)-3-cyano-2-hydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate.
| Compound Name | methyl (2R,3S,4R,5S,6R)-6-(4-bromophenyl)-3-cyano-2-hydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate |
|---|---|
| PubChem CID | 155631828 |
| Molecular Formula | C26H21BrN2O5 |
| Molecular Weight | 521.37 g/mol |
| Exact Mass | 520.06 |
| IUPAC Name | methyl (2R,3S,4R,5S,6R)-6-(4-bromophenyl)-3-cyano-2-hydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](C#N)[C@@]2(O)c3c(OC)cncc3O[C@@]2(c2ccc(Br)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H21BrN2O5/c1-32-19-13-29-14-20-23(19)25(31)18(12-28)21(24(30)33-2)22(15-6-4-3-5-7-15)26(25,34-20)16-8-10-17(27)11-9-16/h3-11,13-14,18,21-22,31H,1-2H3/t18-,21+,22-,25-,26+/m1/s1 |
| InChIKey | WCWITIKSSZIFKY-RVQVOEDGSA-N |
| XLogP | 4.05 |
| TPSA | 101.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |