C31H36BrN3O6 — CID 129180280
tert-butyl N-[2-[[(3R,4S)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]methylamino]ethyl]carbamate (PubChem CID 129180280) has the molecular formula C31H36BrN3O6 and a molecular weight of 626.55 g/mol. Its IUPAC name is tert-butyl N-[2-[[(3R,4S)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(3R,4S)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 129180280 |
| Molecular Formula | C31H36BrN3O6 |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | tert-butyl N-[2-[[(3R,4S)-6-(4-bromophenyl)-2,3-dihydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-4-yl]methylamino]ethyl]carbamate |
| SMILES | COc1cncc2c1C1(O)[C@H](O)[C@H](CNCCNC(=O)OC(C)(C)C)C(c3ccccc3)C1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C31H36BrN3O6/c1-29(2,3)41-28(37)35-15-14-33-16-22-25(19-8-6-5-7-9-19)31(20-10-12-21(32)13-11-20)30(38,27(22)36)26-23(39-4)17-34-18-24(26)40-31/h5-13,17-18,22,25,27,33,36,38H,14-16H2,1-4H3,(H,35,37)/t22-,25?,27-,30?,31?/m1/s1 |
| InChIKey | BWTXXIRHEOTJKI-YJHBPYCQSA-N |
| XLogP | 4.22 |
| TPSA | 122.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|