C17H24N2O8PV- — CID 155635738
CID 155635738 (PubChem CID 155635738) has the molecular formula C17H24N2O8PV- and a molecular weight of 466.30 g/mol.
| Compound Name | CID 155635738 |
|---|---|
| PubChem CID | 155635738 |
| Molecular Formula | C17H24N2O8PV- |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | — |
| SMILES | CC1(C)OC2[C@H](O1)C(COP1(=O)O[CH-]CCO1)O[C@H]2N1C=CCC(C(N)=O)=C1.[V] |
| InChI | InChI=1S/C17H24N2O8P.V/c1-17(2)26-13-12(10-24-28(21)22-7-4-8-23-28)25-16(14(13)27-17)19-6-3-5-11(9-19)15(18)20;/h3,6-7,9,12-14,16H,4-5,8,10H2,1-2H3,(H2,18,20);/q-1;/t12?,13-,14?,16-,28?;/m1./s1 |
| InChIKey | YNBRSCJZURPCOF-LTDIMKNYSA-N |
| XLogP | 1.54 |
| TPSA | 118.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|