C33H25FN4O — CID 155636042
9-(4-tert-butyl-2-pyridinyl)-6-fluoro-2-(3-isocyano-5-pyridin-2-ylphenoxy)carbazole (PubChem CID 155636042) has the molecular formula C33H25FN4O and a molecular weight of 512.59 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-6-fluoro-2-(3-isocyano-5-pyridin-2-ylphenoxy)carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-6-fluoro-2-(3-isocyano-5-pyridin-2-ylphenoxy)carbazole |
|---|---|
| PubChem CID | 155636042 |
| Molecular Formula | C33H25FN4O |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-6-fluoro-2-(3-isocyano-5-pyridin-2-ylphenoxy)carbazole |
| SMILES | [C-]#[N+]c1cc(Oc2ccc3c4cc(F)ccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)cc(-c2ccccn2)c1 |
| InChI | InChI=1S/C33H25FN4O/c1-33(2,3)22-12-14-37-32(17-22)38-30-11-8-23(34)18-28(30)27-10-9-25(20-31(27)38)39-26-16-21(15-24(19-26)35-4)29-7-5-6-13-36-29/h5-20H,1-3H3 |
| InChIKey | XWKTVTTWWOWHJH-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 44.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|