C34H27FN4O — CID 155636092
9-(4-tert-butyl-2-pyridinyl)-2-[2-fluoro-3-isocyano-5-(4-methyl-2-pyridinyl)phenoxy]carbazole (PubChem CID 155636092) has the molecular formula C34H27FN4O and a molecular weight of 526.62 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[2-fluoro-3-isocyano-5-(4-methyl-2-pyridinyl)phenoxy]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[2-fluoro-3-isocyano-5-(4-methyl-2-pyridinyl)phenoxy]carbazole |
|---|---|
| PubChem CID | 155636092 |
| Molecular Formula | C34H27FN4O |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[2-fluoro-3-isocyano-5-(4-methyl-2-pyridinyl)phenoxy]carbazole |
| SMILES | [C-]#[N+]c1cc(-c2cc(C)ccn2)cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)c1F |
| InChI | InChI=1S/C34H27FN4O/c1-21-12-14-37-27(16-21)22-17-28(36-5)33(35)31(18-22)40-24-10-11-26-25-8-6-7-9-29(25)39(30(26)20-24)32-19-23(13-15-38-32)34(2,3)4/h6-20H,1-4H3 |
| InChIKey | CNGNGLNUTOSKIQ-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 44.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|