C36H28FN5O — CID 155636128
9-(4-tert-butyl-2-pyridinyl)-2-[2-fluoro-3-isocyano-5-(1-methylpyrrolo[2,3-c]pyridin-5-yl)phenoxy]carbazole (PubChem CID 155636128) has the molecular formula C36H28FN5O and a molecular weight of 565.65 g/mol. Its IUPAC name is 9-(4-tert-butyl-2-pyridinyl)-2-[2-fluoro-3-isocyano-5-(1-methylpyrrolo[2,3-c]pyridin-5-yl)phenoxy]carbazole.
| Compound Name | 9-(4-tert-butyl-2-pyridinyl)-2-[2-fluoro-3-isocyano-5-(1-methylpyrrolo[2,3-c]pyridin-5-yl)phenoxy]carbazole |
|---|---|
| PubChem CID | 155636128 |
| Molecular Formula | C36H28FN5O |
| Molecular Weight | 565.65 g/mol |
| Exact Mass | 565.23 |
| IUPAC Name | 9-(4-tert-butyl-2-pyridinyl)-2-[2-fluoro-3-isocyano-5-(1-methylpyrrolo[2,3-c]pyridin-5-yl)phenoxy]carbazole |
| SMILES | [C-]#[N+]c1cc(-c2cc3ccn(C)c3cn2)cc(Oc2ccc3c4ccccc4n(-c4cc(C(C)(C)C)ccn4)c3c2)c1F |
| InChI | InChI=1S/C36H28FN5O/c1-36(2,3)24-12-14-39-34(19-24)42-30-9-7-6-8-26(30)27-11-10-25(20-31(27)42)43-33-18-23(17-29(38-4)35(33)37)28-16-22-13-15-41(5)32(22)21-40-28/h6-21H,1-3,5H3 |
| InChIKey | VWNIHCQHPZXSNV-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 49.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.65 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|