C19H31ClN4O2S — CID 155636410
(6-chloro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-[2-[(3-hydroxycyclobutyl)amino]-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone (PubChem CID 155636410) has the molecular formula C19H31ClN4O2S and a molecular weight of 415.00 g/mol. Its IUPAC name is (6-chloro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-[2-[(3-hydroxycyclobutyl)amino]-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone.
| Compound Name | (6-chloro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-[2-[(3-hydroxycyclobutyl)amino]-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone |
|---|---|
| PubChem CID | 155636410 |
| Molecular Formula | C19H31ClN4O2S |
| Molecular Weight | 415.00 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (6-chloro-2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-[2-[(3-hydroxycyclobutyl)amino]-2,3a,4,6,7,7a-hexahydro-1H-[1,3]thiazolo[5,4-c]pyridin-5-yl]methanone |
| SMILES | O=C(C1CC2CCC(Cl)CC2N1)N1CCC2NC(NC3CC(O)C3)SC2C1 |
| InChI | InChI=1S/C19H31ClN4O2S/c20-11-2-1-10-5-16(22-15(10)6-11)18(26)24-4-3-14-17(9-24)27-19(23-14)21-12-7-13(25)8-12/h10-17,19,21-23,25H,1-9H2 |
| InChIKey | BRZKFODIYPTXAB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.00 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|