C20H20O3 — CID 155638342
4-oxo-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaenyl)butanoic acid (PubChem CID 155638342) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 4-oxo-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaenyl)butanoic acid.
| Compound Name | 4-oxo-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaenyl)butanoic acid |
|---|---|
| PubChem CID | 155638342 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-oxo-4-(2-tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaenyl)butanoic acid |
| SMILES | O=C(O)CCC(=O)C1Cc2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C20H20O3/c21-19(11-12-20(22)23)18-13-16-7-2-1-5-14(16)9-10-15-6-3-4-8-17(15)18/h1-8,18H,9-13H2,(H,22,23) |
| InChIKey | MRDVCLXTNGZIQF-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |