C13H19NO3 — CID 155640920
(5R,6R)-6-(propan-2-ylamino)-5,6,7,8-tetrahydronaphthalene-1,3,5-triol (PubChem CID 155640920) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is (5R,6R)-6-(propan-2-ylamino)-5,6,7,8-tetrahydronaphthalene-1,3,5-triol.
| Compound Name | (5R,6R)-6-(propan-2-ylamino)-5,6,7,8-tetrahydronaphthalene-1,3,5-triol |
|---|---|
| PubChem CID | 155640920 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | (5R,6R)-6-(propan-2-ylamino)-5,6,7,8-tetrahydronaphthalene-1,3,5-triol |
| SMILES | CC(C)N[C@@H]1CCc2c(O)cc(O)cc2[C@H]1O |
| InChI | InChI=1S/C13H19NO3/c1-7(2)14-11-4-3-9-10(13(11)17)5-8(15)6-12(9)16/h5-7,11,13-17H,3-4H2,1-2H3/t11-,13-/m1/s1 |
| InChIKey | BDWGTHVYMBWQRJ-DGCLKSJQSA-N |
| XLogP | 1.44 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |