C14H26ClNO5 — CID 90474531
(1R,2R)-5-(hydroxymethyl)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6-diol;dihydrate;hydrochloride (PubChem CID 90474531) has the molecular formula C14H26ClNO5 and a molecular weight of 323.82 g/mol. Its IUPAC name is (1R,2R)-5-(hydroxymethyl)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6-diol;dihydrate;hydrochloride.
| Compound Name | (1R,2R)-5-(hydroxymethyl)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6-diol;dihydrate;hydrochloride |
|---|---|
| PubChem CID | 90474531 |
| Molecular Formula | C14H26ClNO5 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (1R,2R)-5-(hydroxymethyl)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6-diol;dihydrate;hydrochloride |
| SMILES | CC(C)N[C@@H]1CCc2c(ccc(O)c2CO)[C@H]1O.Cl.O.O |
| InChI | InChI=1S/C14H21NO3.ClH.2H2O/c1-8(2)15-12-5-3-9-10(14(12)18)4-6-13(17)11(9)7-16;;;/h4,6,8,12,14-18H,3,5,7H2,1-2H3;1H;2*1H2/t12-,14-;;;/m1.../s1 |
| InChIKey | RDTXKPJLTJSCSP-DYRISMOESA-N |
| XLogP | 0.00 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |