C15H20F3NO5 — CID 138683118
(1S,2S)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6,7-triol;2,2,2-trifluoroacetic acid (PubChem CID 138683118) has the molecular formula C15H20F3NO5 and a molecular weight of 351.32 g/mol. Its IUPAC name is (1S,2S)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6,7-triol;2,2,2-trifluoroacetic acid.
| Compound Name | (1S,2S)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6,7-triol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 138683118 |
| Molecular Formula | C15H20F3NO5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (1S,2S)-2-(propan-2-ylamino)-1,2,3,4-tetrahydronaphthalene-1,6,7-triol;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)N[C@H]1CCc2cc(O)c(O)cc2[C@@H]1O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19NO3.C2HF3O2/c1-7(2)14-10-4-3-8-5-11(15)12(16)6-9(8)13(10)17;3-2(4,5)1(6)7/h5-7,10,13-17H,3-4H2,1-2H3;(H,6,7)/t10-,13-;/m0./s1 |
| InChIKey | AXSRXQYPLNVJOP-VVBGOIRUSA-N |
| XLogP | 2.08 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|