C27H36F6O6 — CID 155645489
2-[2-(4-tert-butylphenyl)propyl]-4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethoxy]carbonyl-2,4-dimethylhexanoic acid (PubChem CID 155645489) has the molecular formula C27H36F6O6 and a molecular weight of 570.57 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)propyl]-4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethoxy]carbonyl-2,4-dimethylhexanoic acid.
| Compound Name | 2-[2-(4-tert-butylphenyl)propyl]-4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethoxy]carbonyl-2,4-dimethylhexanoic acid |
|---|---|
| PubChem CID | 155645489 |
| Molecular Formula | C27H36F6O6 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)propyl]-4-[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethoxy]carbonyl-2,4-dimethylhexanoic acid |
| SMILES | CCC(C)(CC(C)(CC(C)c1ccc(C(C)(C)C)cc1)C(=O)O)C(=O)OCC(=O)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H36F6O6/c1-8-24(6,22(37)38-14-19(34)39-20(26(28,29)30)27(31,32)33)15-25(7,21(35)36)13-16(2)17-9-11-18(12-10-17)23(3,4)5/h9-12,16,20H,8,13-15H2,1-7H3,(H,35,36) |
| InChIKey | UPNBMCSEIVONJO-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |