C24H18BrIrN2O- — CID 155646404
4-bromo-2-(3H-dibenzofuran-3-id-4-yl)-1-(2,4,6-trimethylphenyl)imidazole;iridium (PubChem CID 155646404) has the molecular formula C24H18BrIrN2O- and a molecular weight of 622.54 g/mol. Its IUPAC name is 4-bromo-2-(3H-dibenzofuran-3-id-4-yl)-1-(2,4,6-trimethylphenyl)imidazole;iridium.
| Compound Name | 4-bromo-2-(3H-dibenzofuran-3-id-4-yl)-1-(2,4,6-trimethylphenyl)imidazole;iridium |
|---|---|
| PubChem CID | 155646404 |
| Molecular Formula | C24H18BrIrN2O- |
| Molecular Weight | 622.54 g/mol |
| Exact Mass | 622.02 |
| IUPAC Name | 4-bromo-2-(3H-dibenzofuran-3-id-4-yl)-1-(2,4,6-trimethylphenyl)imidazole;iridium |
| SMILES | Cc1cc(C)c(-n2cc(Br)nc2-c2[c-]ccc3c2oc2ccccc23)c(C)c1.[Ir] |
| InChI | InChI=1S/C24H18BrN2O.Ir/c1-14-11-15(2)22(16(3)12-14)27-13-21(25)26-24(27)19-9-6-8-18-17-7-4-5-10-20(17)28-23(18)19;/h4-8,10-13H,1-3H3;/q-1; |
| InChIKey | PFMUSNCPQZAEIB-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.54 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|