C18H16N4O — CID 155646415
4-(2,6-dimethylphenyl)-3-isocyano-5-(4-methoxyphenyl)-1,2,4-triazole (PubChem CID 155646415) has the molecular formula C18H16N4O and a molecular weight of 304.35 g/mol. Its IUPAC name is 4-(2,6-dimethylphenyl)-3-isocyano-5-(4-methoxyphenyl)-1,2,4-triazole.
| Compound Name | 4-(2,6-dimethylphenyl)-3-isocyano-5-(4-methoxyphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 155646415 |
| Molecular Formula | C18H16N4O |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-(2,6-dimethylphenyl)-3-isocyano-5-(4-methoxyphenyl)-1,2,4-triazole |
| SMILES | [C-]#[N+]c1nnc(-c2ccc(OC)cc2)n1-c1c(C)cccc1C |
| InChI | InChI=1S/C18H16N4O/c1-12-6-5-7-13(2)16(12)22-17(20-21-18(22)19-3)14-8-10-15(23-4)11-9-14/h5-11H,1-2,4H3 |
| InChIKey | SRRRKCUJXRBCHT-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|