C22H38O8 — CID 155649044
1-[4-[2-hydroxy-1-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]phenyl]-2-[2-(2-methoxyethoxy)ethoxy]propan-2-ol (PubChem CID 155649044) has the molecular formula C22H38O8 and a molecular weight of 430.54 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-1-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]phenyl]-2-[2-(2-methoxyethoxy)ethoxy]propan-2-ol.
| Compound Name | 1-[4-[2-hydroxy-1-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]phenyl]-2-[2-(2-methoxyethoxy)ethoxy]propan-2-ol |
|---|---|
| PubChem CID | 155649044 |
| Molecular Formula | C22H38O8 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 1-[4-[2-hydroxy-1-[2-(2-methoxyethoxy)ethoxy]propan-2-yl]phenyl]-2-[2-(2-methoxyethoxy)ethoxy]propan-2-ol |
| SMILES | COCCOCCOCC(C)(O)c1ccc(CC(C)(O)OCCOCCOC)cc1 |
| InChI | InChI=1S/C22H38O8/c1-21(23,18-29-14-13-27-11-9-25-3)20-7-5-19(6-8-20)17-22(2,24)30-16-15-28-12-10-26-4/h5-8,23-24H,9-18H2,1-4H3 |
| InChIKey | HTMFLJZVKCTUHR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|