C29H52O11 — CID 19825439
2-[3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]phenyl]propan-2-ol (PubChem CID 19825439) has the molecular formula C29H52O11 and a molecular weight of 576.72 g/mol. Its IUPAC name is 2-[3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]phenyl]propan-2-ol.
| Compound Name | 2-[3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 19825439 |
| Molecular Formula | C29H52O11 |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.35 |
| IUPAC Name | 2-[3,4-bis[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxymethyl]phenyl]propan-2-ol |
| SMILES | COCCOCCOCCOCCOCc1ccc(C(C)(C)O)cc1COCCOCCOCCOCCOC |
| InChI | InChI=1S/C29H52O11/c1-29(2,30)28-6-5-26(24-39-21-19-37-17-15-35-13-11-33-9-7-31-3)27(23-28)25-40-22-20-38-18-16-36-14-12-34-10-8-32-4/h5-6,23,30H,7-22,24-25H2,1-4H3 |
| InChIKey | NZXPXJXJTNJJQQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|