About 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan
3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan (PubChem CID 155649507) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan.
Analyze 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan?
The IUPAC name of 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan (CID 155649507) is 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan.
What is the SMILES notation for 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan?
The canonical SMILES for 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan is CC(C)C12COCC1COC2.
What is the InChIKey of 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan?
The InChIKey is LDXLBSKQBHZSBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-7(2)9-5-10-3-8(9)4-11-6-9/h7-8H,3-6H2,1-2H3.
What are the key properties of 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan?
3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan has a molecular weight of 156.22 g/mol, XLogP of 1.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3a-propan-2-yl-3,4,6,6a-tetrahydro-1H-furo[3,4-c]furan is sourced from PubChem (CID 155649507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).