C41H36N4O — CID 155649959
4-tert-butyl-11-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxynaphtho[2,1-c][1,5]naphthyridine (PubChem CID 155649959) has the molecular formula C41H36N4O and a molecular weight of 600.77 g/mol. Its IUPAC name is 4-tert-butyl-11-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxynaphtho[2,1-c][1,5]naphthyridine.
| Compound Name | 4-tert-butyl-11-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxynaphtho[2,1-c][1,5]naphthyridine |
|---|---|
| PubChem CID | 155649959 |
| Molecular Formula | C41H36N4O |
| Molecular Weight | 600.77 g/mol |
| Exact Mass | 600.29 |
| IUPAC Name | 4-tert-butyl-11-[9-(4-tert-butyl-2-pyridinyl)carbazol-2-yl]oxynaphtho[2,1-c][1,5]naphthyridine |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3ccc(Oc4ccc5ccc6cnc7c(C(C)(C)C)ccnc7c6c5c4)cc32)c1 |
| InChI | InChI=1S/C41H36N4O/c1-40(2,3)27-17-19-42-36(21-27)45-34-10-8-7-9-30(34)31-16-15-29(23-35(31)45)46-28-14-13-25-11-12-26-24-44-38-33(41(4,5)6)18-20-43-39(38)37(26)32(25)22-28/h7-24H,1-6H3 |
| InChIKey | NRLQZOJZGRXYSL-UHFFFAOYSA-N |
| XLogP | 10.82 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.77 |
| LogP ≤ 5 | 10.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|