C23H16N4O2S2 — CID 155654640
N-[4-[3-(3-hydroxy-4-isocyanophenyl)phenyl]-1,3-thiazol-2-yl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 155654640) has the molecular formula C23H16N4O2S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[4-[3-(3-hydroxy-4-isocyanophenyl)phenyl]-1,3-thiazol-2-yl]-2-methylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[4-[3-(3-hydroxy-4-isocyanophenyl)phenyl]-1,3-thiazol-2-yl]-2-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155654640 |
| Molecular Formula | C23H16N4O2S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | N-[4-[3-(3-hydroxy-4-isocyanophenyl)phenyl]-1,3-thiazol-2-yl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | [C-]#[N+]c1ccc(-c2cccc(-c3csc(NC(=O)c4cccnc4SC)n3)c2)cc1O |
| InChI | InChI=1S/C23H16N4O2S2/c1-24-18-9-8-15(12-20(18)28)14-5-3-6-16(11-14)19-13-31-23(26-19)27-21(29)17-7-4-10-25-22(17)30-2/h3-13,28H,2H3,(H,26,27,29) |
| InChIKey | VCIAYFDRRQMBNF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|