C26H34MnN4O4 — CID 155655037
bis((Z)-4-hydroxypent-3-en-2-one);manganese;4-N,4-N,7-N,7-N-tetramethyl-1,10-phenanthroline-4,7-diamine (PubChem CID 155655037) has the molecular formula C26H34MnN4O4 and a molecular weight of 521.52 g/mol. Its IUPAC name is bis((Z)-4-hydroxypent-3-en-2-one);manganese;4-N,4-N,7-N,7-N-tetramethyl-1,10-phenanthroline-4,7-diamine.
| Compound Name | bis((Z)-4-hydroxypent-3-en-2-one);manganese;4-N,4-N,7-N,7-N-tetramethyl-1,10-phenanthroline-4,7-diamine |
|---|---|
| PubChem CID | 155655037 |
| Molecular Formula | C26H34MnN4O4 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | bis((Z)-4-hydroxypent-3-en-2-one);manganese;4-N,4-N,7-N,7-N-tetramethyl-1,10-phenanthroline-4,7-diamine |
| SMILES | CC(=O)/C=C(/C)O.CC(=O)/C=C(/C)O.CN(C)c1ccnc2c1ccc1c(N(C)C)ccnc12.[Mn] |
| InChI | InChI=1S/C16H18N4.2C5H8O2.Mn/c1-19(2)13-7-9-17-15-11(13)5-6-12-14(20(3)4)8-10-18-16(12)15;2*1-4(6)3-5(2)7;/h5-10H,1-4H3;2*3,6H,1-2H3;/b;2*4-3-; |
| InChIKey | RFINBDPQOWLYGN-QDMRRLORSA-N |
| XLogP | 4.99 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|