About alumane;(Z)-4-hydroxypent-3-en-2-one;manganese
alumane;(Z)-4-hydroxypent-3-en-2-one;manganese (PubChem CID 173263428) has the molecular formula C5H11AlMnO2
and a molecular weight of 185.06 g/mol. Its IUPAC name is alumane;(Z)-4-hydroxypent-3-en-2-one;manganese.
Molecular Properties
| Compound Name | alumane;(Z)-4-hydroxypent-3-en-2-one;manganese |
| PubChem CID | 173263428 |
| Molecular Formula | C5H11AlMnO2 |
| Molecular Weight | 185.06 g/mol |
| Exact Mass | 185.00 |
| IUPAC Name | alumane;(Z)-4-hydroxypent-3-en-2-one;manganese |
| SMILES | CC(=O)/C=C(/C)O.[AlH3].[Mn] |
| InChI | InChI=1S/C5H8O2.Al.Mn.3H/c1-4(6)3-5(2)7;;;;;/h3,6H,1-2H3;;;;;/b4-3-;;;;; |
| InChIKey | LNGZDTODYKPBEK-GLUPTGNJSA-N |
| XLogP | -0.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.06 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze alumane;(Z)-4-hydroxypent-3-en-2-one;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;(Z)-4-hydroxypent-3-en-2-one;manganese?
The IUPAC name of alumane;(Z)-4-hydroxypent-3-en-2-one;manganese (CID 173263428) is alumane;(Z)-4-hydroxypent-3-en-2-one;manganese.
What is the SMILES notation for alumane;(Z)-4-hydroxypent-3-en-2-one;manganese?
The canonical SMILES for alumane;(Z)-4-hydroxypent-3-en-2-one;manganese is CC(=O)/C=C(/C)O.[AlH3].[Mn].
What is the InChIKey of alumane;(Z)-4-hydroxypent-3-en-2-one;manganese?
The InChIKey is LNGZDTODYKPBEK-GLUPTGNJSA-N. The full InChI is InChI=1S/C5H8O2.Al.Mn.3H/c1-4(6)3-5(2)7;;;;;/h3,6H,1-2H3;;;;;/b4-3-;;;;;.
What are the key properties of alumane;(Z)-4-hydroxypent-3-en-2-one;manganese?
alumane;(Z)-4-hydroxypent-3-en-2-one;manganese has a molecular weight of 185.06 g/mol, XLogP of -0.15, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;(Z)-4-hydroxypent-3-en-2-one;manganese is sourced from PubChem (CID 173263428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).