C39H29N3OSi — CID 155655479
(2Z)-4-[2-(10,10-diphenylbenzo[b][1,4]benzoxasilin-4-yl)-6-phenylpyrimidin-4-yl]penta-2,4-dien-1-imine (PubChem CID 155655479) has the molecular formula C39H29N3OSi and a molecular weight of 583.77 g/mol. Its IUPAC name is (2Z)-4-[2-(10,10-diphenylbenzo[b][1,4]benzoxasilin-4-yl)-6-phenylpyrimidin-4-yl]penta-2,4-dien-1-imine.
| Compound Name | (2Z)-4-[2-(10,10-diphenylbenzo[b][1,4]benzoxasilin-4-yl)-6-phenylpyrimidin-4-yl]penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 155655479 |
| Molecular Formula | C39H29N3OSi |
| Molecular Weight | 583.77 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | (2Z)-4-[2-(10,10-diphenylbenzo[b][1,4]benzoxasilin-4-yl)-6-phenylpyrimidin-4-yl]penta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C\C(=C)c1cc(-c2ccccc2)nc(-c2cccc3c2Oc2ccccc2[Si]3(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C39H29N3OSi/c1-28(15-14-26-40)33-27-34(29-16-5-2-6-17-29)42-39(41-33)32-22-13-25-37-38(32)43-35-23-11-12-24-36(35)44(37,30-18-7-3-8-19-30)31-20-9-4-10-21-31/h2-27,40H,1H2/b15-14-,40-26+ |
| InChIKey | FQJQLMHZNBIVGP-SCNYHGTMSA-N |
| XLogP | 6.51 |
| TPSA | 58.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.77 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|