C27H26F3NO5S — CID 155656442
benzyl (2R)-2-[(1R,2R)-2-(2,3-difluorophenyl)-2-(3-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylate (PubChem CID 155656442) has the molecular formula C27H26F3NO5S and a molecular weight of 533.57 g/mol. Its IUPAC name is benzyl (2R)-2-[(1R,2R)-2-(2,3-difluorophenyl)-2-(3-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[(1R,2R)-2-(2,3-difluorophenyl)-2-(3-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 155656442 |
| Molecular Formula | C27H26F3NO5S |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | benzyl (2R)-2-[(1R,2R)-2-(2,3-difluorophenyl)-2-(3-fluorophenyl)-1-methylsulfonyloxyethyl]pyrrolidine-1-carboxylate |
| SMILES | CS(=O)(=O)O[C@H]([C@H](c1cccc(F)c1)c1cccc(F)c1F)[C@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H26F3NO5S/c1-37(33,34)36-26(23-14-7-15-31(23)27(32)35-17-18-8-3-2-4-9-18)24(19-10-5-11-20(28)16-19)21-12-6-13-22(29)25(21)30/h2-6,8-13,16,23-24,26H,7,14-15,17H2,1H3/t23-,24-,26+/m1/s1 |
| InChIKey | FKDNBWITAJKXLQ-MZKUHISZSA-N |
| XLogP | 5.38 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|