C19H22FNO3S — CID 134282127
[(1R,2R)-2-(3-fluorophenyl)-2-phenyl-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate (PubChem CID 134282127) has the molecular formula C19H22FNO3S and a molecular weight of 363.45 g/mol. Its IUPAC name is [(1R,2R)-2-(3-fluorophenyl)-2-phenyl-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate.
| Compound Name | [(1R,2R)-2-(3-fluorophenyl)-2-phenyl-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 134282127 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | [(1R,2R)-2-(3-fluorophenyl)-2-phenyl-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]([C@H](c1ccccc1)c1cccc(F)c1)[C@H]1CCCN1 |
| InChI | InChI=1S/C19H22FNO3S/c1-25(22,23)24-19(17-11-6-12-21-17)18(14-7-3-2-4-8-14)15-9-5-10-16(20)13-15/h2-5,7-10,13,17-19,21H,6,11-12H2,1H3/t17-,18-,19+/m1/s1 |
| InChIKey | PMOYUUCSVKUETF-QRVBRYPASA-N |
| XLogP | 3.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|