C20H22ClF4NO3S — CID 155434307
[2-(4-fluorophenyl)-1-[(2R)-pyrrolidin-2-yl]-2-[3-(trifluoromethyl)phenyl]ethyl] methanesulfonate;hydrochloride (PubChem CID 155434307) has the molecular formula C20H22ClF4NO3S and a molecular weight of 467.91 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-1-[(2R)-pyrrolidin-2-yl]-2-[3-(trifluoromethyl)phenyl]ethyl] methanesulfonate;hydrochloride.
| Compound Name | [2-(4-fluorophenyl)-1-[(2R)-pyrrolidin-2-yl]-2-[3-(trifluoromethyl)phenyl]ethyl] methanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 155434307 |
| Molecular Formula | C20H22ClF4NO3S |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.09 |
| IUPAC Name | [2-(4-fluorophenyl)-1-[(2R)-pyrrolidin-2-yl]-2-[3-(trifluoromethyl)phenyl]ethyl] methanesulfonate;hydrochloride |
| SMILES | CS(=O)(=O)OC(C(c1ccc(F)cc1)c1cccc(C(F)(F)F)c1)[C@H]1CCCN1.Cl |
| InChI | InChI=1S/C20H21F4NO3S.ClH/c1-29(26,27)28-19(17-6-3-11-25-17)18(13-7-9-16(21)10-8-13)14-4-2-5-15(12-14)20(22,23)24;/h2,4-5,7-10,12,17-19,25H,3,6,11H2,1H3;1H/t17-,18?,19?;/m1./s1 |
| InChIKey | OPOJBYDBMVQGCB-SZFIPDBASA-N |
| XLogP | 4.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|