C19H22ClF2NO3S — CID 155434160
[2-(2,3-difluorophenyl)-2-phenyl-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate;hydrochloride (PubChem CID 155434160) has the molecular formula C19H22ClF2NO3S and a molecular weight of 417.91 g/mol. Its IUPAC name is [2-(2,3-difluorophenyl)-2-phenyl-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate;hydrochloride.
| Compound Name | [2-(2,3-difluorophenyl)-2-phenyl-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 155434160 |
| Molecular Formula | C19H22ClF2NO3S |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [2-(2,3-difluorophenyl)-2-phenyl-1-[(2R)-pyrrolidin-2-yl]ethyl] methanesulfonate;hydrochloride |
| SMILES | CS(=O)(=O)OC(C(c1ccccc1)c1cccc(F)c1F)[C@H]1CCCN1.Cl |
| InChI | InChI=1S/C19H21F2NO3S.ClH/c1-26(23,24)25-19(16-11-6-12-22-16)17(13-7-3-2-4-8-13)14-9-5-10-15(20)18(14)21;/h2-5,7-10,16-17,19,22H,6,11-12H2,1H3;1H/t16-,17?,19?;/m1./s1 |
| InChIKey | SWXDMJZJKMMWHR-UORZDKKDSA-N |
| XLogP | 3.62 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|