C20H22FNO5S — CID 134281977
(2R)-2-[(1R,2R)-2-(2-fluorophenyl)-1-methylsulfonyloxy-2-phenylethyl]pyrrolidine-1-carboxylic acid (PubChem CID 134281977) has the molecular formula C20H22FNO5S and a molecular weight of 407.46 g/mol. Its IUPAC name is (2R)-2-[(1R,2R)-2-(2-fluorophenyl)-1-methylsulfonyloxy-2-phenylethyl]pyrrolidine-1-carboxylic acid.
| Compound Name | (2R)-2-[(1R,2R)-2-(2-fluorophenyl)-1-methylsulfonyloxy-2-phenylethyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 134281977 |
| Molecular Formula | C20H22FNO5S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (2R)-2-[(1R,2R)-2-(2-fluorophenyl)-1-methylsulfonyloxy-2-phenylethyl]pyrrolidine-1-carboxylic acid |
| SMILES | CS(=O)(=O)O[C@H]([C@H](c1ccccc1)c1ccccc1F)[C@H]1CCCN1C(=O)O |
| InChI | InChI=1S/C20H22FNO5S/c1-28(25,26)27-19(17-12-7-13-22(17)20(23)24)18(14-8-3-2-4-9-14)15-10-5-6-11-16(15)21/h2-6,8-11,17-19H,7,12-13H2,1H3,(H,23,24)/t17-,18-,19+/m1/s1 |
| InChIKey | AWRHZXUDVIJSMT-QRVBRYPASA-N |
| XLogP | 3.44 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|