C13H17NO6 — CID 155657064
dimethyl 1-butoxy-6-oxopyridine-2,5-dicarboxylate (PubChem CID 155657064) has the molecular formula C13H17NO6 and a molecular weight of 283.28 g/mol. Its IUPAC name is dimethyl 1-butoxy-6-oxopyridine-2,5-dicarboxylate.
| Compound Name | dimethyl 1-butoxy-6-oxopyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 155657064 |
| Molecular Formula | C13H17NO6 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | dimethyl 1-butoxy-6-oxopyridine-2,5-dicarboxylate |
| SMILES | CCCCOn1c(C(=O)OC)ccc(C(=O)OC)c1=O |
| InChI | InChI=1S/C13H17NO6/c1-4-5-8-20-14-10(13(17)19-3)7-6-9(11(14)15)12(16)18-2/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | HCENBQGDQQQXGD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|