2-piperidin-4-ylideneacetic acid

C7H11NO2 — CID 15565784

IUPAC2-piperidin-4-ylideneacetic acid
SMILESO=C(O)C=C1CCNCC1
InChIInChI=1S/C7H11NO2/c9-7(10)5-6-1-3-8-4-2-6/h5,8H,1-4H2,(H,9,10)
InChIKeyJJFAECSHCUBLPC-UHFFFAOYSA-N
MW141.17 g/mol
LogP0.38
Rot. Bonds1

About 2-piperidin-4-ylideneacetic acid

2-piperidin-4-ylideneacetic acid (PubChem CID 15565784) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is 2-piperidin-4-ylideneacetic acid.

Molecular Properties

Compound Name2-piperidin-4-ylideneacetic acid
PubChem CID15565784
Molecular FormulaC7H11NO2
Molecular Weight141.17 g/mol
Exact Mass141.08
IUPAC Name2-piperidin-4-ylideneacetic acid
SMILESO=C(O)C=C1CCNCC1
InChIInChI=1S/C7H11NO2/c9-7(10)5-6-1-3-8-4-2-6/h5,8H,1-4H2,(H,9,10)
InChIKeyJJFAECSHCUBLPC-UHFFFAOYSA-N
XLogP0.38
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.17
LogP ≤ 50.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-piperidin-4-ylideneacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(1-Methylpiperidin-4-ylidene)acetic acid
CID 6484196
(2E)-3-(piperidin-4-yl)prop-2-enoic acid
CID 10057737
2-(1-Methylpiperidin-4-ylidene)acetic acid hydrochloride
CID 71758626
(e)-2-(Piperidin-3-ylidene)acetic acid trifluoroacetic acid salt
CID 66682741
2-Piperidin-3-ylideneacetic acid;2,2,2-trifluoroacetic acid
CID 66682743
Fluorosulfanyl 2-piperidin-4-ylideneacetate
CID 141854501
2-Fluoro-2-(piperidin-4-ylidene)acetic acid
CID 130778205
(2Z)-2-(3-fluoropiperidin-4-ylidene)acetic acid
CID 175401709
2-(3-Fluoropiperidin-4-ylidene)acetic acid
CID 175401711
(2E)-2-(3-fluoropiperidin-4-ylidene)acetic acid
CID 175401740
3-Piperidin-3-ylprop-2-enoic acid
CID 5245985
2-(1-Methylpiperidin-1-ium-4-ylidene)acetate
CID 7219884

Frequently Asked Questions

What is the IUPAC name of 2-piperidin-4-ylideneacetic acid?
The IUPAC name of 2-piperidin-4-ylideneacetic acid (CID 15565784) is 2-piperidin-4-ylideneacetic acid.
What is the SMILES notation for 2-piperidin-4-ylideneacetic acid?
The canonical SMILES for 2-piperidin-4-ylideneacetic acid is O=C(O)C=C1CCNCC1.
What is the InChIKey of 2-piperidin-4-ylideneacetic acid?
The InChIKey is JJFAECSHCUBLPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c9-7(10)5-6-1-3-8-4-2-6/h5,8H,1-4H2,(H,9,10).
What are the key properties of 2-piperidin-4-ylideneacetic acid?
2-piperidin-4-ylideneacetic acid has a molecular weight of 141.17 g/mol, XLogP of 0.38, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylideneacetic acid is sourced from PubChem (CID 15565784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).